C16H28O5S2 — CID 10248237
(1R)-1-[(4R,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-(1,3-dithian-2-yl)ethanol (PubChem CID 10248237) has the molecular formula C16H28O5S2 and a molecular weight of 364.53 g/mol. Its IUPAC name is (1R)-1-[(4R,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-(1,3-dithian-2-yl)ethanol.
| Compound Name | (1R)-1-[(4R,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-(1,3-dithian-2-yl)ethanol |
|---|---|
| PubChem CID | 10248237 |
| Molecular Formula | C16H28O5S2 |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | (1R)-1-[(4R,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-(1,3-dithian-2-yl)ethanol |
| SMILES | CC1(C)O[C@H]([C@H](O)CC2SCCCS2)[C@@H]([C@H]2COC(C)(C)O2)O1 |
| InChI | InChI=1S/C16H28O5S2/c1-15(2)18-9-11(19-15)14-13(20-16(3,4)21-14)10(17)8-12-22-6-5-7-23-12/h10-14,17H,5-9H2,1-4H3/t10-,11-,13-,14-/m1/s1 |
| InChIKey | NZSFYACNJNIYTG-HBJVGIJOSA-N |
| XLogP | 2.61 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |