C25H27NO4 — CID 102482416
2-[dicyclopropylmethyl(9H-fluoren-9-ylmethoxycarbonyl)amino]propanoic acid (PubChem CID 102482416) has the molecular formula C25H27NO4 and a molecular weight of 405.49 g/mol. Its IUPAC name is 2-[dicyclopropylmethyl(9H-fluoren-9-ylmethoxycarbonyl)amino]propanoic acid.
| Compound Name | 2-[dicyclopropylmethyl(9H-fluoren-9-ylmethoxycarbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 102482416 |
| Molecular Formula | C25H27NO4 |
| Molecular Weight | 405.49 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | 2-[dicyclopropylmethyl(9H-fluoren-9-ylmethoxycarbonyl)amino]propanoic acid |
| SMILES | CC(C(=O)O)N(C(=O)OCC1c2ccccc2-c2ccccc21)C(C1CC1)C1CC1 |
| InChI | InChI=1S/C25H27NO4/c1-15(24(27)28)26(23(16-10-11-16)17-12-13-17)25(29)30-14-22-20-8-4-2-6-18(20)19-7-3-5-9-21(19)22/h2-9,15-17,22-23H,10-14H2,1H3,(H,27,28) |
| InChIKey | BNTLMRSISPWBQS-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.49 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |