C11H12BrNO4 — CID 102482671
(4R,5R)-4-(4-bromophenyl)-5-nitrooxan-2-ol (PubChem CID 102482671) has the molecular formula C11H12BrNO4 and a molecular weight of 302.12 g/mol. Its IUPAC name is (4R,5R)-4-(4-bromophenyl)-5-nitrooxan-2-ol.
| Compound Name | (4R,5R)-4-(4-bromophenyl)-5-nitrooxan-2-ol |
|---|---|
| PubChem CID | 102482671 |
| Molecular Formula | C11H12BrNO4 |
| Molecular Weight | 302.12 g/mol |
| Exact Mass | 300.99 |
| IUPAC Name | (4R,5R)-4-(4-bromophenyl)-5-nitrooxan-2-ol |
| SMILES | O=[N+]([O-])[C@H]1COC(O)C[C@@H]1c1ccc(Br)cc1 |
| InChI | InChI=1S/C11H12BrNO4/c12-8-3-1-7(2-4-8)9-5-11(14)17-6-10(9)13(15)16/h1-4,9-11,14H,5-6H2/t9-,10+,11?/m1/s1 |
| InChIKey | YWTUZXLRORCZLE-JKIOLJMWSA-N |
| XLogP | 1.92 |
| TPSA | 72.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.12 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|