C29H21NOS — CID 102482884
(5Z)-2-benzhydrylidene-5-benzylidene-3-phenyl-1,3-thiazolidin-4-one (PubChem CID 102482884) has the molecular formula C29H21NOS and a molecular weight of 431.56 g/mol. Its IUPAC name is (5Z)-2-benzhydrylidene-5-benzylidene-3-phenyl-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-2-benzhydrylidene-5-benzylidene-3-phenyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 102482884 |
| Molecular Formula | C29H21NOS |
| Molecular Weight | 431.56 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | (5Z)-2-benzhydrylidene-5-benzylidene-3-phenyl-1,3-thiazolidin-4-one |
| SMILES | O=c1/c(=C/c2ccccc2)sc(=C(c2ccccc2)c2ccccc2)n1-c1ccccc1 |
| InChI | InChI=1S/C29H21NOS/c31-28-26(21-22-13-5-1-6-14-22)32-29(30(28)25-19-11-4-12-20-25)27(23-15-7-2-8-16-23)24-17-9-3-10-18-24/h1-21H/b26-21- |
| InChIKey | UCUDBYKCHZUDQZ-QLYXXIJNSA-N |
| XLogP | 4.98 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.56 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |