C15H22Br2O — CID 102482901
(3S,4S,6S)-4,10-dibromo-1,5,5,9-tetramethylspiro[5.5]undeca-1,9-dien-3-ol (PubChem CID 102482901) has the molecular formula C15H22Br2O and a molecular weight of 378.15 g/mol. Its IUPAC name is (3S,4S,6S)-4,10-dibromo-1,5,5,9-tetramethylspiro[5.5]undeca-1,9-dien-3-ol.
| Compound Name | (3S,4S,6S)-4,10-dibromo-1,5,5,9-tetramethylspiro[5.5]undeca-1,9-dien-3-ol |
|---|---|
| PubChem CID | 102482901 |
| Molecular Formula | C15H22Br2O |
| Molecular Weight | 378.15 g/mol |
| Exact Mass | 376.00 |
| IUPAC Name | (3S,4S,6S)-4,10-dibromo-1,5,5,9-tetramethylspiro[5.5]undeca-1,9-dien-3-ol |
| SMILES | CC1=C[C@H](O)[C@@H](Br)C(C)(C)[C@]12CCC(C)=C(Br)C2 |
| InChI | InChI=1S/C15H22Br2O/c1-9-5-6-15(8-11(9)16)10(2)7-12(18)13(17)14(15,3)4/h7,12-13,18H,5-6,8H2,1-4H3/t12-,13+,15-/m0/s1 |
| InChIKey | QRVGGXHFBGZNEV-GUTXKFCHSA-N |
| XLogP | 4.94 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.15 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|