C23H31N3O — CID 10248292
2,4,6,7-tetramethyl-2-[(4-phenylpiperazin-1-yl)methyl]-3H-1-benzofuran-5-amine (PubChem CID 10248292) has the molecular formula C23H31N3O and a molecular weight of 365.52 g/mol. Its IUPAC name is 2,4,6,7-tetramethyl-2-[(4-phenylpiperazin-1-yl)methyl]-3H-1-benzofuran-5-amine.
| Compound Name | 2,4,6,7-tetramethyl-2-[(4-phenylpiperazin-1-yl)methyl]-3H-1-benzofuran-5-amine |
|---|---|
| PubChem CID | 10248292 |
| Molecular Formula | C23H31N3O |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.25 |
| IUPAC Name | 2,4,6,7-tetramethyl-2-[(4-phenylpiperazin-1-yl)methyl]-3H-1-benzofuran-5-amine |
| SMILES | Cc1c(C)c2c(c(C)c1N)CC(C)(CN1CCN(c3ccccc3)CC1)O2 |
| InChI | InChI=1S/C23H31N3O/c1-16-17(2)22-20(18(3)21(16)24)14-23(4,27-22)15-25-10-12-26(13-11-25)19-8-6-5-7-9-19/h5-9H,10-15,24H2,1-4H3 |
| InChIKey | FARNOIANKDYBAV-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 41.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|