C15H20F3NO6 — CID 102483027
3-O-[(1R,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopent-2-en-1-yl] 1-O-(2,2,2-trifluoroethyl) propanedioate (PubChem CID 102483027) has the molecular formula C15H20F3NO6 and a molecular weight of 367.32 g/mol. Its IUPAC name is 3-O-[(1R,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopent-2-en-1-yl] 1-O-(2,2,2-trifluoroethyl) propanedioate.
| Compound Name | 3-O-[(1R,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopent-2-en-1-yl] 1-O-(2,2,2-trifluoroethyl) propanedioate |
|---|---|
| PubChem CID | 102483027 |
| Molecular Formula | C15H20F3NO6 |
| Molecular Weight | 367.32 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | 3-O-[(1R,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopent-2-en-1-yl] 1-O-(2,2,2-trifluoroethyl) propanedioate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1C=C[C@H](OC(=O)CC(=O)OCC(F)(F)F)C1 |
| InChI | InChI=1S/C15H20F3NO6/c1-14(2,3)25-13(22)19-9-4-5-10(6-9)24-12(21)7-11(20)23-8-15(16,17)18/h4-5,9-10H,6-8H2,1-3H3,(H,19,22)/t9-,10+/m1/s1 |
| InChIKey | HSUZXGUKFHNNAU-ZJUUUORDSA-N |
| XLogP | 2.25 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.32 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|