C18H22O5 — CID 102483054
(1'R,3R,4'R,8aR)-8a-hydroxy-6,6,8,8-tetramethylspiro[1,2-benzodioxine-3,5'-bicyclo[2.2.1]hept-2-ene]-5,7-dione (PubChem CID 102483054) has the molecular formula C18H22O5 and a molecular weight of 318.37 g/mol. Its IUPAC name is (1'R,3R,4'R,8aR)-8a-hydroxy-6,6,8,8-tetramethylspiro[1,2-benzodioxine-3,5'-bicyclo[2.2.1]hept-2-ene]-5,7-dione.
| Compound Name | (1'R,3R,4'R,8aR)-8a-hydroxy-6,6,8,8-tetramethylspiro[1,2-benzodioxine-3,5'-bicyclo[2.2.1]hept-2-ene]-5,7-dione |
|---|---|
| PubChem CID | 102483054 |
| Molecular Formula | C18H22O5 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | (1'R,3R,4'R,8aR)-8a-hydroxy-6,6,8,8-tetramethylspiro[1,2-benzodioxine-3,5'-bicyclo[2.2.1]hept-2-ene]-5,7-dione |
| SMILES | CC1(C)C(=O)C2=C[C@]3(C[C@@H]4C=C[C@H]3C4)OO[C@]2(O)C(C)(C)C1=O |
| InChI | InChI=1S/C18H22O5/c1-15(2)13(19)12-9-17(8-10-5-6-11(17)7-10)22-23-18(12,21)16(3,4)14(15)20/h5-6,9-11,21H,7-8H2,1-4H3/t10-,11+,17+,18+/m1/s1 |
| InChIKey | VEUHIXAKEUIFCR-LVLBFYMRSA-N |
| XLogP | 2.10 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|