C17H24O2 — CID 102483120
[(1S,2R,6R)-2-hydroxy-2-methyl-6-propylcyclohexyl]-phenylmethanone (PubChem CID 102483120) has the molecular formula C17H24O2 and a molecular weight of 260.38 g/mol. Its IUPAC name is [(1S,2R,6R)-2-hydroxy-2-methyl-6-propylcyclohexyl]-phenylmethanone.
| Compound Name | [(1S,2R,6R)-2-hydroxy-2-methyl-6-propylcyclohexyl]-phenylmethanone |
|---|---|
| PubChem CID | 102483120 |
| Molecular Formula | C17H24O2 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | [(1S,2R,6R)-2-hydroxy-2-methyl-6-propylcyclohexyl]-phenylmethanone |
| SMILES | CCC[C@@H]1CCC[C@@](C)(O)[C@H]1C(=O)c1ccccc1 |
| InChI | InChI=1S/C17H24O2/c1-3-8-13-11-7-12-17(2,19)15(13)16(18)14-9-5-4-6-10-14/h4-6,9-10,13,15,19H,3,7-8,11-12H2,1-2H3/t13-,15-,17-/m1/s1 |
| InChIKey | QTQWWAWMNXQSTQ-FRFSOERESA-N |
| XLogP | 3.84 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |