C22H28O3 — CID 102483125
(3aS,4S,5S,6aS)-4-benzoyl-5-cyclohexyl-3a-hydroxy-6a-methyl-3,4,5,6-tetrahydro-2H-pentalen-1-one (PubChem CID 102483125) has the molecular formula C22H28O3 and a molecular weight of 340.46 g/mol. Its IUPAC name is (3aS,4S,5S,6aS)-4-benzoyl-5-cyclohexyl-3a-hydroxy-6a-methyl-3,4,5,6-tetrahydro-2H-pentalen-1-one.
| Compound Name | (3aS,4S,5S,6aS)-4-benzoyl-5-cyclohexyl-3a-hydroxy-6a-methyl-3,4,5,6-tetrahydro-2H-pentalen-1-one |
|---|---|
| PubChem CID | 102483125 |
| Molecular Formula | C22H28O3 |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | (3aS,4S,5S,6aS)-4-benzoyl-5-cyclohexyl-3a-hydroxy-6a-methyl-3,4,5,6-tetrahydro-2H-pentalen-1-one |
| SMILES | C[C@]12C[C@@H](C3CCCCC3)[C@H](C(=O)c3ccccc3)[C@@]1(O)CCC2=O |
| InChI | InChI=1S/C22H28O3/c1-21-14-17(15-8-4-2-5-9-15)19(22(21,25)13-12-18(21)23)20(24)16-10-6-3-7-11-16/h3,6-7,10-11,15,17,19,25H,2,4-5,8-9,12-14H2,1H3/t17-,19+,21+,22-/m0/s1 |
| InChIKey | BRQSHXLGKISDDC-GWWHBBDRSA-N |
| XLogP | 4.19 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |