About thieno[3,2-f]chromen-7-one
thieno[3,2-f]chromen-7-one (PubChem CID 102483519) has the molecular formula C11H6O2S
and a molecular weight of 202.23 g/mol. Its IUPAC name is thieno[3,2-f]chromen-7-one.
Molecular Properties
| Compound Name | thieno[3,2-f]chromen-7-one |
| PubChem CID | 102483519 |
| Molecular Formula | C11H6O2S |
| Molecular Weight | 202.23 g/mol |
| Exact Mass | 202.01 |
| IUPAC Name | thieno[3,2-f]chromen-7-one |
| SMILES | O=c1ccc2c(ccc3sccc32)o1 |
| InChI | InChI=1S/C11H6O2S/c12-11-4-1-7-8-5-6-14-10(8)3-2-9(7)13-11/h1-6H |
| InChIKey | LMCAHIMOPBINAH-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.23 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze thieno[3,2-f]chromen-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thieno[3,2-f]chromen-7-one?
The IUPAC name of thieno[3,2-f]chromen-7-one (CID 102483519) is thieno[3,2-f]chromen-7-one.
What is the SMILES notation for thieno[3,2-f]chromen-7-one?
The canonical SMILES for thieno[3,2-f]chromen-7-one is O=c1ccc2c(ccc3sccc32)o1.
What is the InChIKey of thieno[3,2-f]chromen-7-one?
The InChIKey is LMCAHIMOPBINAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H6O2S/c12-11-4-1-7-8-5-6-14-10(8)3-2-9(7)13-11/h1-6H.
What are the key properties of thieno[3,2-f]chromen-7-one?
thieno[3,2-f]chromen-7-one has a molecular weight of 202.23 g/mol, XLogP of 3.01, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for thieno[3,2-f]chromen-7-one is sourced from PubChem (CID 102483519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).