C14H14O3 — CID 102483534
(2R,3aR,6aR)-3a-methyl-3-methylidene-2-phenyl-6,6a-dihydrofuro[3,2-b]furan-5-one (PubChem CID 102483534) has the molecular formula C14H14O3 and a molecular weight of 230.26 g/mol. Its IUPAC name is (2R,3aR,6aR)-3a-methyl-3-methylidene-2-phenyl-6,6a-dihydrofuro[3,2-b]furan-5-one.
| Compound Name | (2R,3aR,6aR)-3a-methyl-3-methylidene-2-phenyl-6,6a-dihydrofuro[3,2-b]furan-5-one |
|---|---|
| PubChem CID | 102483534 |
| Molecular Formula | C14H14O3 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | (2R,3aR,6aR)-3a-methyl-3-methylidene-2-phenyl-6,6a-dihydrofuro[3,2-b]furan-5-one |
| SMILES | C=C1[C@@H](c2ccccc2)O[C@@H]2CC(=O)O[C@]12C |
| InChI | InChI=1S/C14H14O3/c1-9-13(10-6-4-3-5-7-10)16-11-8-12(15)17-14(9,11)2/h3-7,11,13H,1,8H2,2H3/t11-,13+,14-/m1/s1 |
| InChIKey | XNASKWFVYMXWIP-KWCYVHTRSA-N |
| XLogP | 2.39 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|