About methyl 2-[(8R,10S)-8-ethyl-9-oxa-1,5-dithiaspiro[5.5]undecan-10-yl]acetate
methyl 2-[(8R,10S)-8-ethyl-9-oxa-1,5-dithiaspiro[5.5]undecan-10-yl]acetate (PubChem CID 102483784) has the molecular formula C13H22O3S2
and a molecular weight of 290.45 g/mol. Its IUPAC name is methyl 2-[(8R,10S)-8-ethyl-9-oxa-1,5-dithiaspiro[5.5]undecan-10-yl]acetate.
Molecular Properties
| Compound Name | methyl 2-[(8R,10S)-8-ethyl-9-oxa-1,5-dithiaspiro[5.5]undecan-10-yl]acetate |
| PubChem CID | 102483784 |
| Molecular Formula | C13H22O3S2 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | methyl 2-[(8R,10S)-8-ethyl-9-oxa-1,5-dithiaspiro[5.5]undecan-10-yl]acetate |
| SMILES | CC[C@@H]1CC2(C[C@H](CC(=O)OC)O1)SCCCS2 |
| InChI | InChI=1S/C13H22O3S2/c1-3-10-8-13(17-5-4-6-18-13)9-11(16-10)7-12(14)15-2/h10-11H,3-9H2,1-2H3/t10-,11+/m1/s1 |
| InChIKey | BAZJEOQAASSYOS-MNOVXSKESA-N |
| XLogP | 3.07 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 2-[(8R,10S)-8-ethyl-9-oxa-1,5-dithiaspiro[5.5]undecan-10-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(8R,10S)-8-ethyl-9-oxa-1,5-dithiaspiro[5.5]undecan-10-yl]acetate?
The IUPAC name of methyl 2-[(8R,10S)-8-ethyl-9-oxa-1,5-dithiaspiro[5.5]undecan-10-yl]acetate (CID 102483784) is methyl 2-[(8R,10S)-8-ethyl-9-oxa-1,5-dithiaspiro[5.5]undecan-10-yl]acetate.
What is the SMILES notation for methyl 2-[(8R,10S)-8-ethyl-9-oxa-1,5-dithiaspiro[5.5]undecan-10-yl]acetate?
The canonical SMILES for methyl 2-[(8R,10S)-8-ethyl-9-oxa-1,5-dithiaspiro[5.5]undecan-10-yl]acetate is CC[C@@H]1CC2(C[C@H](CC(=O)OC)O1)SCCCS2.
What is the InChIKey of methyl 2-[(8R,10S)-8-ethyl-9-oxa-1,5-dithiaspiro[5.5]undecan-10-yl]acetate?
The InChIKey is BAZJEOQAASSYOS-MNOVXSKESA-N. The full InChI is InChI=1S/C13H22O3S2/c1-3-10-8-13(17-5-4-6-18-13)9-11(16-10)7-12(14)15-2/h10-11H,3-9H2,1-2H3/t10-,11+/m1/s1.
What are the key properties of methyl 2-[(8R,10S)-8-ethyl-9-oxa-1,5-dithiaspiro[5.5]undecan-10-yl]acetate?
methyl 2-[(8R,10S)-8-ethyl-9-oxa-1,5-dithiaspiro[5.5]undecan-10-yl]acetate has a molecular weight of 290.45 g/mol, XLogP of 3.07, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(8R,10S)-8-ethyl-9-oxa-1,5-dithiaspiro[5.5]undecan-10-yl]acetate is sourced from PubChem (CID 102483784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).