C16H25NO — CID 102483820
(6Z,9Z,10aS)-7-hexyl-2,3,8,10a-tetrahydro-1H-pyrrolo[1,2-a]azocin-5-one (PubChem CID 102483820) has the molecular formula C16H25NO and a molecular weight of 247.38 g/mol. Its IUPAC name is (6Z,9Z,10aS)-7-hexyl-2,3,8,10a-tetrahydro-1H-pyrrolo[1,2-a]azocin-5-one.
| Compound Name | (6Z,9Z,10aS)-7-hexyl-2,3,8,10a-tetrahydro-1H-pyrrolo[1,2-a]azocin-5-one |
|---|---|
| PubChem CID | 102483820 |
| Molecular Formula | C16H25NO |
| Molecular Weight | 247.38 g/mol |
| Exact Mass | 247.19 |
| IUPAC Name | (6Z,9Z,10aS)-7-hexyl-2,3,8,10a-tetrahydro-1H-pyrrolo[1,2-a]azocin-5-one |
| SMILES | CCCCCC/C1=C/C(=O)N2CCC[C@H]2/C=C\C1 |
| InChI | InChI=1S/C16H25NO/c1-2-3-4-5-8-14-9-6-10-15-11-7-12-17(15)16(18)13-14/h6,10,13,15H,2-5,7-9,11-12H2,1H3/b10-6-,14-13-/t15-/m1/s1 |
| InChIKey | OEVZRNQNCHZVPF-YJSLAMENSA-N |
| XLogP | 3.83 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.38 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|