C20H23NO2 — CID 102483995
(E)-1-(2',2'-dimethylspiro[4H-1,2-oxazole-5,3'-bicyclo[2.2.1]heptane]-3-yl)-3-phenylprop-2-en-1-one (PubChem CID 102483995) has the molecular formula C20H23NO2 and a molecular weight of 309.41 g/mol. Its IUPAC name is (E)-1-(2',2'-dimethylspiro[4H-1,2-oxazole-5,3'-bicyclo[2.2.1]heptane]-3-yl)-3-phenylprop-2-en-1-one.
| Compound Name | (E)-1-(2',2'-dimethylspiro[4H-1,2-oxazole-5,3'-bicyclo[2.2.1]heptane]-3-yl)-3-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 102483995 |
| Molecular Formula | C20H23NO2 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | (E)-1-(2',2'-dimethylspiro[4H-1,2-oxazole-5,3'-bicyclo[2.2.1]heptane]-3-yl)-3-phenylprop-2-en-1-one |
| SMILES | CC1(C)C2CCC(C2)C12CC(C(=O)/C=C/c1ccccc1)=NO2 |
| InChI | InChI=1S/C20H23NO2/c1-19(2)15-9-10-16(12-15)20(19)13-17(21-23-20)18(22)11-8-14-6-4-3-5-7-14/h3-8,11,15-16H,9-10,12-13H2,1-2H3/b11-8+ |
| InChIKey | UDWQKXWNWRIJMX-DHZHZOJOSA-N |
| XLogP | 4.24 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|