C18H28O6Si — CID 10248469
methyl (5R,6S)-6-[tert-butyl(dimethyl)silyl]oxy-5-(3-methoxy-2,3-dioxopropyl)cyclohexa-1,3-diene-1-carboxylate (PubChem CID 10248469) has the molecular formula C18H28O6Si and a molecular weight of 368.50 g/mol. Its IUPAC name is methyl (5R,6S)-6-[tert-butyl(dimethyl)silyl]oxy-5-(3-methoxy-2,3-dioxopropyl)cyclohexa-1,3-diene-1-carboxylate.
| Compound Name | methyl (5R,6S)-6-[tert-butyl(dimethyl)silyl]oxy-5-(3-methoxy-2,3-dioxopropyl)cyclohexa-1,3-diene-1-carboxylate |
|---|---|
| PubChem CID | 10248469 |
| Molecular Formula | C18H28O6Si |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | methyl (5R,6S)-6-[tert-butyl(dimethyl)silyl]oxy-5-(3-methoxy-2,3-dioxopropyl)cyclohexa-1,3-diene-1-carboxylate |
| SMILES | COC(=O)C(=O)C[C@@H]1C=CC=C(C(=O)OC)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H28O6Si/c1-18(2,3)25(6,7)24-15-12(11-14(19)17(21)23-5)9-8-10-13(15)16(20)22-4/h8-10,12,15H,11H2,1-7H3/t12-,15-/m0/s1 |
| InChIKey | JEQVXMHQPQBXJY-WFASDCNBSA-N |
| XLogP | 2.79 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|