About 4,8-dimethoxy-9-phenyl-2,3-dihydro-1H-phenalen-1-ol
4,8-dimethoxy-9-phenyl-2,3-dihydro-1H-phenalen-1-ol (PubChem CID 102484717) has the molecular formula C21H20O3
and a molecular weight of 320.39 g/mol. Its IUPAC name is 4,8-dimethoxy-9-phenyl-2,3-dihydro-1H-phenalen-1-ol.
Molecular Properties
| Compound Name | 4,8-dimethoxy-9-phenyl-2,3-dihydro-1H-phenalen-1-ol |
| PubChem CID | 102484717 |
| Molecular Formula | C21H20O3 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | 4,8-dimethoxy-9-phenyl-2,3-dihydro-1H-phenalen-1-ol |
| SMILES | COc1cc2ccc(OC)c3c2c(c1-c1ccccc1)C(O)CC3 |
| InChI | InChI=1S/C21H20O3/c1-23-17-11-8-14-12-18(24-2)20(13-6-4-3-5-7-13)21-16(22)10-9-15(17)19(14)21/h3-8,11-12,16,22H,9-10H2,1-2H3 |
| InChIKey | JVSRXOPVLSBOLX-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4,8-dimethoxy-9-phenyl-2,3-dihydro-1H-phenalen-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,8-dimethoxy-9-phenyl-2,3-dihydro-1H-phenalen-1-ol?
The IUPAC name of 4,8-dimethoxy-9-phenyl-2,3-dihydro-1H-phenalen-1-ol (CID 102484717) is 4,8-dimethoxy-9-phenyl-2,3-dihydro-1H-phenalen-1-ol.
What is the SMILES notation for 4,8-dimethoxy-9-phenyl-2,3-dihydro-1H-phenalen-1-ol?
The canonical SMILES for 4,8-dimethoxy-9-phenyl-2,3-dihydro-1H-phenalen-1-ol is COc1cc2ccc(OC)c3c2c(c1-c1ccccc1)C(O)CC3.
What is the InChIKey of 4,8-dimethoxy-9-phenyl-2,3-dihydro-1H-phenalen-1-ol?
The InChIKey is JVSRXOPVLSBOLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20O3/c1-23-17-11-8-14-12-18(24-2)20(13-6-4-3-5-7-13)21-16(22)10-9-15(17)19(14)21/h3-8,11-12,16,22H,9-10H2,1-2H3.
What are the key properties of 4,8-dimethoxy-9-phenyl-2,3-dihydro-1H-phenalen-1-ol?
4,8-dimethoxy-9-phenyl-2,3-dihydro-1H-phenalen-1-ol has a molecular weight of 320.39 g/mol, XLogP of 4.50, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,8-dimethoxy-9-phenyl-2,3-dihydro-1H-phenalen-1-ol is sourced from PubChem (CID 102484717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).