C17H19NO3Se — CID 102485002
(1S,2S,6R)-3-phenylselanyl-5-oxa-10-azatricyclo[8.3.0.02,6]tridecane-4,11-dione (PubChem CID 102485002) has the molecular formula C17H19NO3Se and a molecular weight of 364.30 g/mol. Its IUPAC name is (1S,2S,6R)-3-phenylselanyl-5-oxa-10-azatricyclo[8.3.0.02,6]tridecane-4,11-dione.
| Compound Name | (1S,2S,6R)-3-phenylselanyl-5-oxa-10-azatricyclo[8.3.0.02,6]tridecane-4,11-dione |
|---|---|
| PubChem CID | 102485002 |
| Molecular Formula | C17H19NO3Se |
| Molecular Weight | 364.30 g/mol |
| Exact Mass | 365.05 |
| IUPAC Name | (1S,2S,6R)-3-phenylselanyl-5-oxa-10-azatricyclo[8.3.0.02,6]tridecane-4,11-dione |
| SMILES | O=C1O[C@@H]2CCCN3C(=O)CC[C@H]3[C@@H]2C1[Se]c1ccccc1 |
| InChI | InChI=1S/C17H19NO3Se/c19-14-9-8-12-15-13(7-4-10-18(12)14)21-17(20)16(15)22-11-5-2-1-3-6-11/h1-3,5-6,12-13,15-16H,4,7-10H2/t12-,13+,15-,16?/m0/s1 |
| InChIKey | QTPPNPFFFRBRNV-CSOLROPVSA-N |
| XLogP | 1.13 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.30 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|