C15H25O5P — CID 102485306
3-butyl-4-diethoxyphosphoryl-1,4,6,6a-tetrahydrocyclopenta[c]furan-5-one (PubChem CID 102485306) has the molecular formula C15H25O5P and a molecular weight of 316.33 g/mol. Its IUPAC name is 3-butyl-4-diethoxyphosphoryl-1,4,6,6a-tetrahydrocyclopenta[c]furan-5-one.
| Compound Name | 3-butyl-4-diethoxyphosphoryl-1,4,6,6a-tetrahydrocyclopenta[c]furan-5-one |
|---|---|
| PubChem CID | 102485306 |
| Molecular Formula | C15H25O5P |
| Molecular Weight | 316.33 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 3-butyl-4-diethoxyphosphoryl-1,4,6,6a-tetrahydrocyclopenta[c]furan-5-one |
| SMILES | CCCCC1=C2C(CO1)CC(=O)C2P(=O)(OCC)OCC |
| InChI | InChI=1S/C15H25O5P/c1-4-7-8-13-14-11(10-18-13)9-12(16)15(14)21(17,19-5-2)20-6-3/h11,15H,4-10H2,1-3H3 |
| InChIKey | YHRNFOBSKLKBEV-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.33 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|