C37H24N4O4 — CID 102485472
1,1,1',1'-tetramethyl-3,3'-spirobi[2H-cyclopenta[i]oxanthrene]-6,6',9,9'-tetracarbonitrile (PubChem CID 102485472) has the molecular formula C37H24N4O4 and a molecular weight of 588.62 g/mol. Its IUPAC name is 1,1,1',1'-tetramethyl-3,3'-spirobi[2H-cyclopenta[i]oxanthrene]-6,6',9,9'-tetracarbonitrile.
| Compound Name | 1,1,1',1'-tetramethyl-3,3'-spirobi[2H-cyclopenta[i]oxanthrene]-6,6',9,9'-tetracarbonitrile |
|---|---|
| PubChem CID | 102485472 |
| Molecular Formula | C37H24N4O4 |
| Molecular Weight | 588.62 g/mol |
| Exact Mass | 588.18 |
| IUPAC Name | 1,1,1',1'-tetramethyl-3,3'-spirobi[2H-cyclopenta[i]oxanthrene]-6,6',9,9'-tetracarbonitrile |
| SMILES | CC1(C)CC2(CC(C)(C)c3cc4c(cc32)Oc2c(C#N)ccc(C#N)c2O4)c2cc3c(cc21)Oc1c(C#N)ccc(C#N)c1O3 |
| InChI | InChI=1S/C37H24N4O4/c1-35(2)17-37(25-11-29-27(9-23(25)35)42-31-19(13-38)5-7-21(15-40)33(31)44-29)18-36(3,4)24-10-28-30(12-26(24)37)45-34-22(16-41)8-6-20(14-39)32(34)43-28/h5-12H,17-18H2,1-4H3 |
| InChIKey | GILDGZJTNIKUMF-UHFFFAOYSA-N |
| XLogP | 8.62 |
| TPSA | 132.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.62 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |