About 1-O-[2,6-di(propan-2-yl)phenyl] 3-O-ethyl (2S)-2-hydroxy-2-[(2S)-1-oxo-3-phenylpropan-2-yl]propanedioate
1-O-[2,6-di(propan-2-yl)phenyl] 3-O-ethyl (2S)-2-hydroxy-2-[(2S)-1-oxo-3-phenylpropan-2-yl]propanedioate (PubChem CID 102485507) has the molecular formula C26H32O6
and a molecular weight of 440.54 g/mol. Its IUPAC name is 1-O-[2,6-di(propan-2-yl)phenyl] 3-O-ethyl (2S)-2-hydroxy-2-[(2S)-1-oxo-3-phenylpropan-2-yl]propanedioate.
Molecular Properties
| Compound Name | 1-O-[2,6-di(propan-2-yl)phenyl] 3-O-ethyl (2S)-2-hydroxy-2-[(2S)-1-oxo-3-phenylpropan-2-yl]propanedioate |
| PubChem CID | 102485507 |
| Molecular Formula | C26H32O6 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | 1-O-[2,6-di(propan-2-yl)phenyl] 3-O-ethyl (2S)-2-hydroxy-2-[(2S)-1-oxo-3-phenylpropan-2-yl]propanedioate |
| SMILES | CCOC(=O)[C@](O)(C(=O)Oc1c(C(C)C)cccc1C(C)C)[C@@H](C=O)Cc1ccccc1 |
| InChI | InChI=1S/C26H32O6/c1-6-31-24(28)26(30,20(16-27)15-19-11-8-7-9-12-19)25(29)32-23-21(17(2)3)13-10-14-22(23)18(4)5/h7-14,16-18,20,30H,6,15H2,1-5H3/t20-,26+/m1/s1 |
| InChIKey | GSLUIGRYPZXKOQ-IBVKSMDESA-N |
| XLogP | 4.19 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 1-O-[2,6-di(propan-2-yl)phenyl] 3-O-ethyl (2S)-2-hydroxy-2-[(2S)-1-oxo-3-phenylpropan-2-yl]propanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-[2,6-di(propan-2-yl)phenyl] 3-O-ethyl (2S)-2-hydroxy-2-[(2S)-1-oxo-3-phenylpropan-2-yl]propanedioate?
The IUPAC name of 1-O-[2,6-di(propan-2-yl)phenyl] 3-O-ethyl (2S)-2-hydroxy-2-[(2S)-1-oxo-3-phenylpropan-2-yl]propanedioate (CID 102485507) is 1-O-[2,6-di(propan-2-yl)phenyl] 3-O-ethyl (2S)-2-hydroxy-2-[(2S)-1-oxo-3-phenylpropan-2-yl]propanedioate.
What is the SMILES notation for 1-O-[2,6-di(propan-2-yl)phenyl] 3-O-ethyl (2S)-2-hydroxy-2-[(2S)-1-oxo-3-phenylpropan-2-yl]propanedioate?
The canonical SMILES for 1-O-[2,6-di(propan-2-yl)phenyl] 3-O-ethyl (2S)-2-hydroxy-2-[(2S)-1-oxo-3-phenylpropan-2-yl]propanedioate is CCOC(=O)[C@](O)(C(=O)Oc1c(C(C)C)cccc1C(C)C)[C@@H](C=O)Cc1ccccc1.
What is the InChIKey of 1-O-[2,6-di(propan-2-yl)phenyl] 3-O-ethyl (2S)-2-hydroxy-2-[(2S)-1-oxo-3-phenylpropan-2-yl]propanedioate?
The InChIKey is GSLUIGRYPZXKOQ-IBVKSMDESA-N. The full InChI is InChI=1S/C26H32O6/c1-6-31-24(28)26(30,20(16-27)15-19-11-8-7-9-12-19)25(29)32-23-21(17(2)3)13-10-14-22(23)18(4)5/h7-14,16-18,20,30H,6,15H2,1-5H3/t20-,26+/m1/s1.
What are the key properties of 1-O-[2,6-di(propan-2-yl)phenyl] 3-O-ethyl (2S)-2-hydroxy-2-[(2S)-1-oxo-3-phenylpropan-2-yl]propanedioate?
1-O-[2,6-di(propan-2-yl)phenyl] 3-O-ethyl (2S)-2-hydroxy-2-[(2S)-1-oxo-3-phenylpropan-2-yl]propanedioate has a molecular weight of 440.54 g/mol, XLogP of 4.19, 10 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-[2,6-di(propan-2-yl)phenyl] 3-O-ethyl (2S)-2-hydroxy-2-[(2S)-1-oxo-3-phenylpropan-2-yl]propanedioate is sourced from PubChem (CID 102485507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).