C31H32IN5O7 — CID 102485573
[(2R,3S)-5-[6-iodo-2-[(2-methylpropan-2-yl)oxycarbonylamino]purin-9-yl]-3-(4-methylbenzoyl)oxyoxolan-2-yl]methyl 4-methylbenzoate (PubChem CID 102485573) has the molecular formula C31H32IN5O7 and a molecular weight of 713.53 g/mol. Its IUPAC name is [(2R,3S)-5-[6-iodo-2-[(2-methylpropan-2-yl)oxycarbonylamino]purin-9-yl]-3-(4-methylbenzoyl)oxyoxolan-2-yl]methyl 4-methylbenzoate.
| Compound Name | [(2R,3S)-5-[6-iodo-2-[(2-methylpropan-2-yl)oxycarbonylamino]purin-9-yl]-3-(4-methylbenzoyl)oxyoxolan-2-yl]methyl 4-methylbenzoate |
|---|---|
| PubChem CID | 102485573 |
| Molecular Formula | C31H32IN5O7 |
| Molecular Weight | 713.53 g/mol |
| Exact Mass | 713.13 |
| IUPAC Name | [(2R,3S)-5-[6-iodo-2-[(2-methylpropan-2-yl)oxycarbonylamino]purin-9-yl]-3-(4-methylbenzoyl)oxyoxolan-2-yl]methyl 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)OC[C@H]2OC(n3cnc4c(I)nc(NC(=O)OC(C)(C)C)nc43)C[C@@H]2OC(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C31H32IN5O7/c1-17-6-10-19(11-7-17)27(38)41-15-22-21(43-28(39)20-12-8-18(2)9-13-20)14-23(42-22)37-16-33-24-25(32)34-29(35-26(24)37)36-30(40)44-31(3,4)5/h6-13,16,21-23H,14-15H2,1-5H3,(H,34,35,36,40)/t21-,22+,23?/m0/s1 |
| InChIKey | NDFOEQADSLPDMI-ZVTBYLAHSA-N |
| XLogP | 5.76 |
| TPSA | 143.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.53 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|