About [4-bromo-2-(1,3-oxathian-2-yl)phenyl]imino-triphenyl-λ5-phosphane
[4-bromo-2-(1,3-oxathian-2-yl)phenyl]imino-triphenyl-λ5-phosphane (PubChem CID 102485647) has the molecular formula C28H25BrNOPS
and a molecular weight of 534.46 g/mol. Its IUPAC name is [4-bromo-2-(1,3-oxathian-2-yl)phenyl]imino-triphenyl-λ5-phosphane.
Molecular Properties
| Compound Name | [4-bromo-2-(1,3-oxathian-2-yl)phenyl]imino-triphenyl-λ5-phosphane |
| PubChem CID | 102485647 |
| Molecular Formula | C28H25BrNOPS |
| Molecular Weight | 534.46 g/mol |
| Exact Mass | 533.06 |
| IUPAC Name | [4-bromo-2-(1,3-oxathian-2-yl)phenyl]imino-triphenyl-λ5-phosphane |
| SMILES | Brc1ccc(N=P(c2ccccc2)(c2ccccc2)c2ccccc2)c(C2OCCCS2)c1 |
| InChI | InChI=1S/C28H25BrNOPS/c29-22-17-18-27(26(21-22)28-31-19-10-20-33-28)30-32(23-11-4-1-5-12-23,24-13-6-2-7-14-24)25-15-8-3-9-16-25/h1-9,11-18,21,28H,10,19-20H2 |
| InChIKey | ZAKDDAYNJSOHMH-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 534.46 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [4-bromo-2-(1,3-oxathian-2-yl)phenyl]imino-triphenyl-λ5-phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-bromo-2-(1,3-oxathian-2-yl)phenyl]imino-triphenyl-λ5-phosphane?
The IUPAC name of [4-bromo-2-(1,3-oxathian-2-yl)phenyl]imino-triphenyl-λ5-phosphane (CID 102485647) is [4-bromo-2-(1,3-oxathian-2-yl)phenyl]imino-triphenyl-λ5-phosphane.
What is the SMILES notation for [4-bromo-2-(1,3-oxathian-2-yl)phenyl]imino-triphenyl-λ5-phosphane?
The canonical SMILES for [4-bromo-2-(1,3-oxathian-2-yl)phenyl]imino-triphenyl-λ5-phosphane is Brc1ccc(N=P(c2ccccc2)(c2ccccc2)c2ccccc2)c(C2OCCCS2)c1.
What is the InChIKey of [4-bromo-2-(1,3-oxathian-2-yl)phenyl]imino-triphenyl-λ5-phosphane?
The InChIKey is ZAKDDAYNJSOHMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H25BrNOPS/c29-22-17-18-27(26(21-22)28-31-19-10-20-33-28)30-32(23-11-4-1-5-12-23,24-13-6-2-7-14-24)25-15-8-3-9-16-25/h1-9,11-18,21,28H,10,19-20H2.
What are the key properties of [4-bromo-2-(1,3-oxathian-2-yl)phenyl]imino-triphenyl-λ5-phosphane?
[4-bromo-2-(1,3-oxathian-2-yl)phenyl]imino-triphenyl-λ5-phosphane has a molecular weight of 534.46 g/mol, XLogP of 7.41, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-bromo-2-(1,3-oxathian-2-yl)phenyl]imino-triphenyl-λ5-phosphane is sourced from PubChem (CID 102485647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).