C44H35NO4S — CID 102485732
[(3R,4S)-4-[(4-methylphenyl)sulfonyl-prop-2-ynylamino]-3-naphthalen-2-yl-1,5-diphenylpent-1-yn-3-yl] benzoate (PubChem CID 102485732) has the molecular formula C44H35NO4S and a molecular weight of 673.83 g/mol. Its IUPAC name is [(3R,4S)-4-[(4-methylphenyl)sulfonyl-prop-2-ynylamino]-3-naphthalen-2-yl-1,5-diphenylpent-1-yn-3-yl] benzoate.
| Compound Name | [(3R,4S)-4-[(4-methylphenyl)sulfonyl-prop-2-ynylamino]-3-naphthalen-2-yl-1,5-diphenylpent-1-yn-3-yl] benzoate |
|---|---|
| PubChem CID | 102485732 |
| Molecular Formula | C44H35NO4S |
| Molecular Weight | 673.83 g/mol |
| Exact Mass | 673.23 |
| IUPAC Name | [(3R,4S)-4-[(4-methylphenyl)sulfonyl-prop-2-ynylamino]-3-naphthalen-2-yl-1,5-diphenylpent-1-yn-3-yl] benzoate |
| SMILES | C#CCN([C@@H](Cc1ccccc1)[C@@](C#Cc1ccccc1)(OC(=O)c1ccccc1)c1ccc2ccccc2c1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C44H35NO4S/c1-3-31-45(50(47,48)41-27-23-34(2)24-28-41)42(32-36-17-9-5-10-18-36)44(30-29-35-15-7-4-8-16-35,49-43(46)38-20-11-6-12-21-38)40-26-25-37-19-13-14-22-39(37)33-40/h1,4-28,33,42H,31-32H2,2H3/t42-,44-/m0/s1 |
| InChIKey | WSNUPQINAMPNPE-YMJVKMAGSA-N |
| XLogP | 8.19 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.83 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|