C22H28O5 — CID 10248708
(1S,2S,6S,7S,9R,13R,17S)-4,15-dimethoxy-2,6,14,17-tetramethyl-10-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-4,11,14-triene-3,16-dione (PubChem CID 10248708) has the molecular formula C22H28O5 and a molecular weight of 372.46 g/mol. Its IUPAC name is (1S,2S,6S,7S,9R,13R,17S)-4,15-dimethoxy-2,6,14,17-tetramethyl-10-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-4,11,14-triene-3,16-dione.
| Compound Name | (1S,2S,6S,7S,9R,13R,17S)-4,15-dimethoxy-2,6,14,17-tetramethyl-10-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-4,11,14-triene-3,16-dione |
|---|---|
| PubChem CID | 10248708 |
| Molecular Formula | C22H28O5 |
| Molecular Weight | 372.46 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | (1S,2S,6S,7S,9R,13R,17S)-4,15-dimethoxy-2,6,14,17-tetramethyl-10-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-4,11,14-triene-3,16-dione |
| SMILES | COC1=C[C@@H](C)[C@@H]2C[C@H]3OC=C[C@H]4C(C)=C(OC)C(=O)[C@H]([C@@]2(C)C1=O)[C@@]34C |
| InChI | InChI=1S/C22H28O5/c1-11-9-15(25-5)20(24)22(4)14(11)10-16-21(3)13(7-8-27-16)12(2)18(26-6)17(23)19(21)22/h7-9,11,13-14,16,19H,10H2,1-6H3/t11-,13+,14+,16-,19+,21-,22+/m1/s1 |
| InChIKey | OAQOMMAQCRZTLU-KCNLDMQWSA-N |
| XLogP | 3.42 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.46 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |