About methyl 7-azabicyclo[4.1.0]hepta-1(7),2,4-triene-2-carboxylate
methyl 7-azabicyclo[4.1.0]hepta-1(7),2,4-triene-2-carboxylate (PubChem CID 102487256) has the molecular formula C8H7NO2
and a molecular weight of 149.15 g/mol. Its IUPAC name is methyl 7-azabicyclo[4.1.0]hepta-1(7),2,4-triene-2-carboxylate.
Molecular Properties
| Compound Name | methyl 7-azabicyclo[4.1.0]hepta-1(7),2,4-triene-2-carboxylate |
| PubChem CID | 102487256 |
| Molecular Formula | C8H7NO2 |
| Molecular Weight | 149.15 g/mol |
| Exact Mass | 149.05 |
| IUPAC Name | methyl 7-azabicyclo[4.1.0]hepta-1(7),2,4-triene-2-carboxylate |
| SMILES | COC(=O)C1=CC=CC2N=C12 |
| InChI | InChI=1S/C8H7NO2/c1-11-8(10)5-3-2-4-6-7(5)9-6/h2-4,6H,1H3 |
| InChIKey | IGTLBRIYCTWUMZ-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.15 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 7-azabicyclo[4.1.0]hepta-1(7),2,4-triene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 7-azabicyclo[4.1.0]hepta-1(7),2,4-triene-2-carboxylate?
The IUPAC name of methyl 7-azabicyclo[4.1.0]hepta-1(7),2,4-triene-2-carboxylate (CID 102487256) is methyl 7-azabicyclo[4.1.0]hepta-1(7),2,4-triene-2-carboxylate.
What is the SMILES notation for methyl 7-azabicyclo[4.1.0]hepta-1(7),2,4-triene-2-carboxylate?
The canonical SMILES for methyl 7-azabicyclo[4.1.0]hepta-1(7),2,4-triene-2-carboxylate is COC(=O)C1=CC=CC2N=C12.
What is the InChIKey of methyl 7-azabicyclo[4.1.0]hepta-1(7),2,4-triene-2-carboxylate?
The InChIKey is IGTLBRIYCTWUMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NO2/c1-11-8(10)5-3-2-4-6-7(5)9-6/h2-4,6H,1H3.
What are the key properties of methyl 7-azabicyclo[4.1.0]hepta-1(7),2,4-triene-2-carboxylate?
methyl 7-azabicyclo[4.1.0]hepta-1(7),2,4-triene-2-carboxylate has a molecular weight of 149.15 g/mol, XLogP of 0.48, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 7-azabicyclo[4.1.0]hepta-1(7),2,4-triene-2-carboxylate is sourced from PubChem (CID 102487256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).