C19H40O3Si2 — CID 10248733
trans-(3R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methylidenecyclohexan-1-ol (PubChem CID 10248733) has the molecular formula C19H40O3Si2 and a molecular weight of 372.70 g/mol. Its IUPAC name is trans-(3R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methylidenecyclohexan-1-ol.
| Compound Name | trans-(3R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methylidenecyclohexan-1-ol |
|---|---|
| PubChem CID | 10248733 |
| Molecular Formula | C19H40O3Si2 |
| Molecular Weight | 372.70 g/mol |
| Exact Mass | 372.25 |
| IUPAC Name | trans-(3R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methylidenecyclohexan-1-ol |
| SMILES | C=C1[C@H](O[Si](C)(C)C(C)(C)C)CC(O)C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H40O3Si2/c1-14-16(21-23(8,9)18(2,3)4)12-15(20)13-17(14)22-24(10,11)19(5,6)7/h15-17,20H,1,12-13H2,2-11H3/t16-,17-/m1/s1 |
| InChIKey | ONBKNVFNXKTBBJ-IAGOWNOFSA-N |
| XLogP | 5.48 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.70 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|