C21H38O2 — CID 102487409
(4R,5S,6S,8E,12E)-4,8,12-triethyl-5-hydroxy-6-methyltetradeca-8,12-dien-3-one (PubChem CID 102487409) has the molecular formula C21H38O2 and a molecular weight of 322.53 g/mol. Its IUPAC name is (4R,5S,6S,8E,12E)-4,8,12-triethyl-5-hydroxy-6-methyltetradeca-8,12-dien-3-one.
| Compound Name | (4R,5S,6S,8E,12E)-4,8,12-triethyl-5-hydroxy-6-methyltetradeca-8,12-dien-3-one |
|---|---|
| PubChem CID | 102487409 |
| Molecular Formula | C21H38O2 |
| Molecular Weight | 322.53 g/mol |
| Exact Mass | 322.29 |
| IUPAC Name | (4R,5S,6S,8E,12E)-4,8,12-triethyl-5-hydroxy-6-methyltetradeca-8,12-dien-3-one |
| SMILES | C/C=C(\CC)CC/C=C(\CC)C[C@H](C)[C@H](O)C(CC)C(=O)CC |
| InChI | InChI=1S/C21H38O2/c1-7-17(8-2)13-12-14-18(9-3)15-16(6)21(23)19(10-4)20(22)11-5/h7,14,16,19,21,23H,8-13,15H2,1-6H3/b17-7+,18-14+/t16-,19?,21-/m0/s1 |
| InChIKey | RIAOMYRFEXWECY-YKUNDYJLSA-N |
| XLogP | 5.85 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.53 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|