About 2-phenylbut-3-en-2-yl N-methylcarbamate
2-phenylbut-3-en-2-yl N-methylcarbamate (PubChem CID 102487562) has the molecular formula C12H15NO2
and a molecular weight of 205.26 g/mol. Its IUPAC name is 2-phenylbut-3-en-2-yl N-methylcarbamate.
Molecular Properties
| Compound Name | 2-phenylbut-3-en-2-yl N-methylcarbamate |
| PubChem CID | 102487562 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | 2-phenylbut-3-en-2-yl N-methylcarbamate |
| SMILES | C=CC(C)(OC(=O)NC)c1ccccc1 |
| InChI | InChI=1S/C12H15NO2/c1-4-12(2,15-11(14)13-3)10-8-6-5-7-9-10/h4-9H,1H2,2-3H3,(H,13,14) |
| InChIKey | XLALXMQMMNCAST-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-phenylbut-3-en-2-yl N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylbut-3-en-2-yl N-methylcarbamate?
The IUPAC name of 2-phenylbut-3-en-2-yl N-methylcarbamate (CID 102487562) is 2-phenylbut-3-en-2-yl N-methylcarbamate.
What is the SMILES notation for 2-phenylbut-3-en-2-yl N-methylcarbamate?
The canonical SMILES for 2-phenylbut-3-en-2-yl N-methylcarbamate is C=CC(C)(OC(=O)NC)c1ccccc1.
What is the InChIKey of 2-phenylbut-3-en-2-yl N-methylcarbamate?
The InChIKey is XLALXMQMMNCAST-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO2/c1-4-12(2,15-11(14)13-3)10-8-6-5-7-9-10/h4-9H,1H2,2-3H3,(H,13,14).
What are the key properties of 2-phenylbut-3-en-2-yl N-methylcarbamate?
2-phenylbut-3-en-2-yl N-methylcarbamate has a molecular weight of 205.26 g/mol, XLogP of 2.44, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylbut-3-en-2-yl N-methylcarbamate is sourced from PubChem (CID 102487562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).