About methyl (E)-3-(4-hydroxy-2,2-diphenyl-1,3-benzodioxol-5-yl)prop-2-enoate
methyl (E)-3-(4-hydroxy-2,2-diphenyl-1,3-benzodioxol-5-yl)prop-2-enoate (PubChem CID 10248822) has the molecular formula C23H18O5
and a molecular weight of 374.39 g/mol. Its IUPAC name is methyl (E)-3-(4-hydroxy-2,2-diphenyl-1,3-benzodioxol-5-yl)prop-2-enoate.
Molecular Properties
| Compound Name | methyl (E)-3-(4-hydroxy-2,2-diphenyl-1,3-benzodioxol-5-yl)prop-2-enoate |
| PubChem CID | 10248822 |
| Molecular Formula | C23H18O5 |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | methyl (E)-3-(4-hydroxy-2,2-diphenyl-1,3-benzodioxol-5-yl)prop-2-enoate |
| SMILES | COC(=O)/C=C/c1ccc2c(c1O)OC(c1ccccc1)(c1ccccc1)O2 |
| InChI | InChI=1S/C23H18O5/c1-26-20(24)15-13-16-12-14-19-22(21(16)25)28-23(27-19,17-8-4-2-5-9-17)18-10-6-3-7-11-18/h2-15,25H,1H3/b15-13+ |
| InChIKey | FPAHXCCJXSQURR-FYWRMAATSA-N |
| XLogP | 4.25 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl (E)-3-(4-hydroxy-2,2-diphenyl-1,3-benzodioxol-5-yl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (E)-3-(4-hydroxy-2,2-diphenyl-1,3-benzodioxol-5-yl)prop-2-enoate?
The IUPAC name of methyl (E)-3-(4-hydroxy-2,2-diphenyl-1,3-benzodioxol-5-yl)prop-2-enoate (CID 10248822) is methyl (E)-3-(4-hydroxy-2,2-diphenyl-1,3-benzodioxol-5-yl)prop-2-enoate.
What is the SMILES notation for methyl (E)-3-(4-hydroxy-2,2-diphenyl-1,3-benzodioxol-5-yl)prop-2-enoate?
The canonical SMILES for methyl (E)-3-(4-hydroxy-2,2-diphenyl-1,3-benzodioxol-5-yl)prop-2-enoate is COC(=O)/C=C/c1ccc2c(c1O)OC(c1ccccc1)(c1ccccc1)O2.
What is the InChIKey of methyl (E)-3-(4-hydroxy-2,2-diphenyl-1,3-benzodioxol-5-yl)prop-2-enoate?
The InChIKey is FPAHXCCJXSQURR-FYWRMAATSA-N. The full InChI is InChI=1S/C23H18O5/c1-26-20(24)15-13-16-12-14-19-22(21(16)25)28-23(27-19,17-8-4-2-5-9-17)18-10-6-3-7-11-18/h2-15,25H,1H3/b15-13+.
What are the key properties of methyl (E)-3-(4-hydroxy-2,2-diphenyl-1,3-benzodioxol-5-yl)prop-2-enoate?
methyl (E)-3-(4-hydroxy-2,2-diphenyl-1,3-benzodioxol-5-yl)prop-2-enoate has a molecular weight of 374.39 g/mol, XLogP of 4.25, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (E)-3-(4-hydroxy-2,2-diphenyl-1,3-benzodioxol-5-yl)prop-2-enoate is sourced from PubChem (CID 10248822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).