C29H28N2O5S — CID 102488789
(6-methoxy-1-methyl-2-sulfanylidenequinolin-4-yl)methyl (2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoate (PubChem CID 102488789) has the molecular formula C29H28N2O5S and a molecular weight of 516.62 g/mol. Its IUPAC name is (6-methoxy-1-methyl-2-sulfanylidenequinolin-4-yl)methyl (2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoate.
| Compound Name | (6-methoxy-1-methyl-2-sulfanylidenequinolin-4-yl)methyl (2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 102488789 |
| Molecular Formula | C29H28N2O5S |
| Molecular Weight | 516.62 g/mol |
| Exact Mass | 516.17 |
| IUPAC Name | (6-methoxy-1-methyl-2-sulfanylidenequinolin-4-yl)methyl (2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoate |
| SMILES | COc1ccc2c(c1)c(COC(=O)[C@H](Cc1ccccc1)NC(=O)OCc1ccccc1)cc(=S)n2C |
| InChI | InChI=1S/C29H28N2O5S/c1-31-26-14-13-23(34-2)17-24(26)22(16-27(31)37)19-35-28(32)25(15-20-9-5-3-6-10-20)30-29(33)36-18-21-11-7-4-8-12-21/h3-14,16-17,25H,15,18-19H2,1-2H3,(H,30,33)/t25-/m0/s1 |
| InChIKey | DMUNPYARJRXQNC-VWLOTQADSA-N |
| XLogP | 5.50 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.62 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|