C31H52O6 — CID 102489025
[(2R)-2,3-bis[[(E)-2-methylbut-2-enoyl]oxy]propyl] (Z)-octadec-9-enoate (PubChem CID 102489025) has the molecular formula C31H52O6 and a molecular weight of 520.75 g/mol. Its IUPAC name is [(2R)-2,3-bis[[(E)-2-methylbut-2-enoyl]oxy]propyl] (Z)-octadec-9-enoate.
| Compound Name | [(2R)-2,3-bis[[(E)-2-methylbut-2-enoyl]oxy]propyl] (Z)-octadec-9-enoate |
|---|---|
| PubChem CID | 102489025 |
| Molecular Formula | C31H52O6 |
| Molecular Weight | 520.75 g/mol |
| Exact Mass | 520.38 |
| IUPAC Name | [(2R)-2,3-bis[[(E)-2-methylbut-2-enoyl]oxy]propyl] (Z)-octadec-9-enoate |
| SMILES | C/C=C(\C)C(=O)OC[C@@H](COC(=O)CCCCCCC/C=C\CCCCCCCC)OC(=O)/C(C)=C/C |
| InChI | InChI=1S/C31H52O6/c1-6-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-29(32)35-24-28(37-31(34)27(5)8-3)25-36-30(33)26(4)7-2/h7-8,15-16,28H,6,9-14,17-25H2,1-5H3/b16-15-,26-7+,27-8+/t28-/m1/s1 |
| InChIKey | PNDBQQWQICNMAP-PLLQWVPGSA-N |
| XLogP | 7.95 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.75 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|