C31H48O4Si2 — CID 102489108
2-[(2R,4S,6S)-4-[tert-butyl(dimethyl)silyl]oxy-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]oxan-2-yl]acetaldehyde (PubChem CID 102489108) has the molecular formula C31H48O4Si2 and a molecular weight of 540.89 g/mol. Its IUPAC name is 2-[(2R,4S,6S)-4-[tert-butyl(dimethyl)silyl]oxy-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]oxan-2-yl]acetaldehyde.
| Compound Name | 2-[(2R,4S,6S)-4-[tert-butyl(dimethyl)silyl]oxy-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]oxan-2-yl]acetaldehyde |
|---|---|
| PubChem CID | 102489108 |
| Molecular Formula | C31H48O4Si2 |
| Molecular Weight | 540.89 g/mol |
| Exact Mass | 540.31 |
| IUPAC Name | 2-[(2R,4S,6S)-4-[tert-butyl(dimethyl)silyl]oxy-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]oxan-2-yl]acetaldehyde |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1C[C@H](CC=O)O[C@@H](CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C1 |
| InChI | InChI=1S/C31H48O4Si2/c1-30(2,3)36(7,8)35-27-23-25(19-21-32)34-26(24-27)20-22-33-37(31(4,5)6,28-15-11-9-12-16-28)29-17-13-10-14-18-29/h9-18,21,25-27H,19-20,22-24H2,1-8H3/t25-,26-,27+/m0/s1 |
| InChIKey | OYPQPMZRMMTTFI-GMQQYTKMSA-N |
| XLogP | 6.48 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.89 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|