C21H20N4O3 — CID 10248940
3-[1-(3-aminopropyl)pyrrolo[2,3-b]pyridin-3-yl]-4-(2-methoxyphenyl)pyrrole-2,5-dione (PubChem CID 10248940) has the molecular formula C21H20N4O3 and a molecular weight of 376.42 g/mol. Its IUPAC name is 3-[1-(3-aminopropyl)pyrrolo[2,3-b]pyridin-3-yl]-4-(2-methoxyphenyl)pyrrole-2,5-dione.
| Compound Name | 3-[1-(3-aminopropyl)pyrrolo[2,3-b]pyridin-3-yl]-4-(2-methoxyphenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 10248940 |
| Molecular Formula | C21H20N4O3 |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | 3-[1-(3-aminopropyl)pyrrolo[2,3-b]pyridin-3-yl]-4-(2-methoxyphenyl)pyrrole-2,5-dione |
| SMILES | COc1ccccc1C1=C(c2cn(CCCN)c3ncccc23)C(=O)NC1=O |
| InChI | InChI=1S/C21H20N4O3/c1-28-16-8-3-2-6-14(16)17-18(21(27)24-20(17)26)15-12-25(11-5-9-22)19-13(15)7-4-10-23-19/h2-4,6-8,10,12H,5,9,11,22H2,1H3,(H,24,26,27) |
| InChIKey | JSHYUYIZSJJCKS-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|