About ethyl N-[(1R,2S)-2-bromo-1-(2,5-dioxopyrrolidin-1-yl)propyl]carbamate
ethyl N-[(1R,2S)-2-bromo-1-(2,5-dioxopyrrolidin-1-yl)propyl]carbamate (PubChem CID 102489557) has the molecular formula C10H15BrN2O4
and a molecular weight of 307.14 g/mol. Its IUPAC name is ethyl N-[(1R,2S)-2-bromo-1-(2,5-dioxopyrrolidin-1-yl)propyl]carbamate.
Molecular Properties
| Compound Name | ethyl N-[(1R,2S)-2-bromo-1-(2,5-dioxopyrrolidin-1-yl)propyl]carbamate |
| PubChem CID | 102489557 |
| Molecular Formula | C10H15BrN2O4 |
| Molecular Weight | 307.14 g/mol |
| Exact Mass | 306.02 |
| IUPAC Name | ethyl N-[(1R,2S)-2-bromo-1-(2,5-dioxopyrrolidin-1-yl)propyl]carbamate |
| SMILES | CCOC(=O)N[C@@H]([C@H](C)Br)N1C(=O)CCC1=O |
| InChI | InChI=1S/C10H15BrN2O4/c1-3-17-10(16)12-9(6(2)11)13-7(14)4-5-8(13)15/h6,9H,3-5H2,1-2H3,(H,12,16)/t6-,9+/m0/s1 |
| InChIKey | HFEQZYCZIDJXTK-IMTBSYHQSA-N |
| XLogP | 0.99 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.14 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze ethyl N-[(1R,2S)-2-bromo-1-(2,5-dioxopyrrolidin-1-yl)propyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-[(1R,2S)-2-bromo-1-(2,5-dioxopyrrolidin-1-yl)propyl]carbamate?
The IUPAC name of ethyl N-[(1R,2S)-2-bromo-1-(2,5-dioxopyrrolidin-1-yl)propyl]carbamate (CID 102489557) is ethyl N-[(1R,2S)-2-bromo-1-(2,5-dioxopyrrolidin-1-yl)propyl]carbamate.
What is the SMILES notation for ethyl N-[(1R,2S)-2-bromo-1-(2,5-dioxopyrrolidin-1-yl)propyl]carbamate?
The canonical SMILES for ethyl N-[(1R,2S)-2-bromo-1-(2,5-dioxopyrrolidin-1-yl)propyl]carbamate is CCOC(=O)N[C@@H]([C@H](C)Br)N1C(=O)CCC1=O.
What is the InChIKey of ethyl N-[(1R,2S)-2-bromo-1-(2,5-dioxopyrrolidin-1-yl)propyl]carbamate?
The InChIKey is HFEQZYCZIDJXTK-IMTBSYHQSA-N. The full InChI is InChI=1S/C10H15BrN2O4/c1-3-17-10(16)12-9(6(2)11)13-7(14)4-5-8(13)15/h6,9H,3-5H2,1-2H3,(H,12,16)/t6-,9+/m0/s1.
What are the key properties of ethyl N-[(1R,2S)-2-bromo-1-(2,5-dioxopyrrolidin-1-yl)propyl]carbamate?
ethyl N-[(1R,2S)-2-bromo-1-(2,5-dioxopyrrolidin-1-yl)propyl]carbamate has a molecular weight of 307.14 g/mol, XLogP of 0.99, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-[(1R,2S)-2-bromo-1-(2,5-dioxopyrrolidin-1-yl)propyl]carbamate is sourced from PubChem (CID 102489557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).