About 2,7-dichloro-9-(2-methylphenyl)-9H-xanthene-3,6-diol
2,7-dichloro-9-(2-methylphenyl)-9H-xanthene-3,6-diol (PubChem CID 102489706) has the molecular formula C20H14Cl2O3
and a molecular weight of 373.24 g/mol. Its IUPAC name is 2,7-dichloro-9-(2-methylphenyl)-9H-xanthene-3,6-diol.
Molecular Properties
| Compound Name | 2,7-dichloro-9-(2-methylphenyl)-9H-xanthene-3,6-diol |
| PubChem CID | 102489706 |
| Molecular Formula | C20H14Cl2O3 |
| Molecular Weight | 373.24 g/mol |
| Exact Mass | 372.03 |
| IUPAC Name | 2,7-dichloro-9-(2-methylphenyl)-9H-xanthene-3,6-diol |
| SMILES | Cc1ccccc1C1c2cc(Cl)c(O)cc2Oc2cc(O)c(Cl)cc21 |
| InChI | InChI=1S/C20H14Cl2O3/c1-10-4-2-3-5-11(10)20-12-6-14(21)16(23)8-18(12)25-19-9-17(24)15(22)7-13(19)20/h2-9,20,23-24H,1H3 |
| InChIKey | DRNSIXBFBRMBCE-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 373.24 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,7-dichloro-9-(2-methylphenyl)-9H-xanthene-3,6-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,7-dichloro-9-(2-methylphenyl)-9H-xanthene-3,6-diol?
The IUPAC name of 2,7-dichloro-9-(2-methylphenyl)-9H-xanthene-3,6-diol (CID 102489706) is 2,7-dichloro-9-(2-methylphenyl)-9H-xanthene-3,6-diol.
What is the SMILES notation for 2,7-dichloro-9-(2-methylphenyl)-9H-xanthene-3,6-diol?
The canonical SMILES for 2,7-dichloro-9-(2-methylphenyl)-9H-xanthene-3,6-diol is Cc1ccccc1C1c2cc(Cl)c(O)cc2Oc2cc(O)c(Cl)cc21.
What is the InChIKey of 2,7-dichloro-9-(2-methylphenyl)-9H-xanthene-3,6-diol?
The InChIKey is DRNSIXBFBRMBCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H14Cl2O3/c1-10-4-2-3-5-11(10)20-12-6-14(21)16(23)8-18(12)25-19-9-17(24)15(22)7-13(19)20/h2-9,20,23-24H,1H3.
What are the key properties of 2,7-dichloro-9-(2-methylphenyl)-9H-xanthene-3,6-diol?
2,7-dichloro-9-(2-methylphenyl)-9H-xanthene-3,6-diol has a molecular weight of 373.24 g/mol, XLogP of 6.00, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,7-dichloro-9-(2-methylphenyl)-9H-xanthene-3,6-diol is sourced from PubChem (CID 102489706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).