C14H23NOSiTe — CID 10248995
[(1S,4R)-4,7,7-trimethyl-3-trimethylsilyloxy-2-bicyclo[2.2.1]hept-2-enyl] tellurocyanate (PubChem CID 10248995) has the molecular formula C14H23NOSiTe and a molecular weight of 377.03 g/mol. Its IUPAC name is [(1S,4R)-4,7,7-trimethyl-3-trimethylsilyloxy-2-bicyclo[2.2.1]hept-2-enyl] tellurocyanate.
| Compound Name | [(1S,4R)-4,7,7-trimethyl-3-trimethylsilyloxy-2-bicyclo[2.2.1]hept-2-enyl] tellurocyanate |
|---|---|
| PubChem CID | 10248995 |
| Molecular Formula | C14H23NOSiTe |
| Molecular Weight | 377.03 g/mol |
| Exact Mass | 379.06 |
| IUPAC Name | [(1S,4R)-4,7,7-trimethyl-3-trimethylsilyloxy-2-bicyclo[2.2.1]hept-2-enyl] tellurocyanate |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(C)C(O[Si](C)(C)C)=C2[Te]C#N |
| InChI | InChI=1S/C14H23NOSiTe/c1-13(2)10-7-8-14(13,3)12(11(10)18-9-15)16-17(4,5)6/h10H,7-8H2,1-6H3/t10-,14+/m1/s1 |
| InChIKey | BJSDTOVFKVRBPJ-YGRLFVJLSA-N |
| XLogP | 3.69 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.03 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|