C35H24N4O2 — CID 102490183
4-(N-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]-4-formylanilino)benzaldehyde (PubChem CID 102490183) has the molecular formula C35H24N4O2 and a molecular weight of 532.60 g/mol. Its IUPAC name is 4-(N-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]-4-formylanilino)benzaldehyde.
| Compound Name | 4-(N-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]-4-formylanilino)benzaldehyde |
|---|---|
| PubChem CID | 102490183 |
| Molecular Formula | C35H24N4O2 |
| Molecular Weight | 532.60 g/mol |
| Exact Mass | 532.19 |
| IUPAC Name | 4-(N-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]-4-formylanilino)benzaldehyde |
| SMILES | O=Cc1ccc(N(c2ccc(C=O)cc2)c2ccc(-c3cc(-c4ccccn4)nc(-c4ccccn4)c3)cc2)cc1 |
| InChI | InChI=1S/C35H24N4O2/c40-23-25-7-13-29(14-8-25)39(30-15-9-26(24-41)10-16-30)31-17-11-27(12-18-31)28-21-34(32-5-1-3-19-36-32)38-35(22-28)33-6-2-4-20-37-33/h1-24H |
| InChIKey | UREDXVPVZSRHSR-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 76.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.60 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|