C17H32O5P2 — CID 10249060
[hydroxy-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]phosphoryl]methylphosphonic acid (PubChem CID 10249060) has the molecular formula C17H32O5P2 and a molecular weight of 378.39 g/mol. Its IUPAC name is [hydroxy-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]phosphoryl]methylphosphonic acid.
| Compound Name | [hydroxy-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]phosphoryl]methylphosphonic acid |
|---|---|
| PubChem CID | 10249060 |
| Molecular Formula | C17H32O5P2 |
| Molecular Weight | 378.39 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | [hydroxy-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]phosphoryl]methylphosphonic acid |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CCP(=O)(O)CP(=O)(O)O |
| InChI | InChI=1S/C17H32O5P2/c1-15(2)8-5-9-16(3)10-6-11-17(4)12-7-13-23(18,19)14-24(20,21)22/h8,10,12H,5-7,9,11,13-14H2,1-4H3,(H,18,19)(H2,20,21,22)/b16-10+,17-12+ |
| InChIKey | OPTQBHLRSXBIHD-JTCWOHKRSA-N |
| XLogP | 5.20 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.39 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|