C16H12N4OS — CID 102490715
12-(4-methoxyphenyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-amine (PubChem CID 102490715) has the molecular formula C16H12N4OS and a molecular weight of 308.37 g/mol. Its IUPAC name is 12-(4-methoxyphenyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-amine.
| Compound Name | 12-(4-methoxyphenyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-amine |
|---|---|
| PubChem CID | 102490715 |
| Molecular Formula | C16H12N4OS |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | 12-(4-methoxyphenyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-amine |
| SMILES | COc1ccc(-c2cnc3sc4c(N)ncnc4c3c2)cc1 |
| InChI | InChI=1S/C16H12N4OS/c1-21-11-4-2-9(3-5-11)10-6-12-13-14(15(17)20-8-19-13)22-16(12)18-7-10/h2-8H,1H3,(H2,17,19,20) |
| InChIKey | LMOBYGWAACPURY-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 73.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |