About 5-[(E)-2-(4-chlorophenyl)ethenyl]-2,3-dimethylfuran
5-[(E)-2-(4-chlorophenyl)ethenyl]-2,3-dimethylfuran (PubChem CID 102491221) has the molecular formula C14H13ClO
and a molecular weight of 232.71 g/mol. Its IUPAC name is 5-[(E)-2-(4-chlorophenyl)ethenyl]-2,3-dimethylfuran.
Molecular Properties
| Compound Name | 5-[(E)-2-(4-chlorophenyl)ethenyl]-2,3-dimethylfuran |
| PubChem CID | 102491221 |
| Molecular Formula | C14H13ClO |
| Molecular Weight | 232.71 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | 5-[(E)-2-(4-chlorophenyl)ethenyl]-2,3-dimethylfuran |
| SMILES | Cc1cc(/C=C/c2ccc(Cl)cc2)oc1C |
| InChI | InChI=1S/C14H13ClO/c1-10-9-14(16-11(10)2)8-5-12-3-6-13(15)7-4-12/h3-9H,1-2H3/b8-5+ |
| InChIKey | BCYKYIADBKXUGI-VMPITWQZSA-N |
| XLogP | 4.72 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.71 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-[(E)-2-(4-chlorophenyl)ethenyl]-2,3-dimethylfuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(E)-2-(4-chlorophenyl)ethenyl]-2,3-dimethylfuran?
The IUPAC name of 5-[(E)-2-(4-chlorophenyl)ethenyl]-2,3-dimethylfuran (CID 102491221) is 5-[(E)-2-(4-chlorophenyl)ethenyl]-2,3-dimethylfuran.
What is the SMILES notation for 5-[(E)-2-(4-chlorophenyl)ethenyl]-2,3-dimethylfuran?
The canonical SMILES for 5-[(E)-2-(4-chlorophenyl)ethenyl]-2,3-dimethylfuran is Cc1cc(/C=C/c2ccc(Cl)cc2)oc1C.
What is the InChIKey of 5-[(E)-2-(4-chlorophenyl)ethenyl]-2,3-dimethylfuran?
The InChIKey is BCYKYIADBKXUGI-VMPITWQZSA-N. The full InChI is InChI=1S/C14H13ClO/c1-10-9-14(16-11(10)2)8-5-12-3-6-13(15)7-4-12/h3-9H,1-2H3/b8-5+.
What are the key properties of 5-[(E)-2-(4-chlorophenyl)ethenyl]-2,3-dimethylfuran?
5-[(E)-2-(4-chlorophenyl)ethenyl]-2,3-dimethylfuran has a molecular weight of 232.71 g/mol, XLogP of 4.72, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(E)-2-(4-chlorophenyl)ethenyl]-2,3-dimethylfuran is sourced from PubChem (CID 102491221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).