C28H28O2 — CID 102491243
ethyl (E,4Z)-4-benzylidene-5-methyl-3,6-diphenylhex-5-enoate (PubChem CID 102491243) has the molecular formula C28H28O2 and a molecular weight of 396.53 g/mol. Its IUPAC name is ethyl (E,4Z)-4-benzylidene-5-methyl-3,6-diphenylhex-5-enoate.
| Compound Name | ethyl (E,4Z)-4-benzylidene-5-methyl-3,6-diphenylhex-5-enoate |
|---|---|
| PubChem CID | 102491243 |
| Molecular Formula | C28H28O2 |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.21 |
| IUPAC Name | ethyl (E,4Z)-4-benzylidene-5-methyl-3,6-diphenylhex-5-enoate |
| SMILES | CCOC(=O)CC(C(=C/c1ccccc1)/C(C)=C/c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H28O2/c1-3-30-28(29)21-27(25-17-11-6-12-18-25)26(20-24-15-9-5-10-16-24)22(2)19-23-13-7-4-8-14-23/h4-20,27H,3,21H2,1-2H3/b22-19+,26-20+ |
| InChIKey | SBTIFLQDKOQARU-ICVJNYQFSA-N |
| XLogP | 6.91 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|