C24H24N2O3 — CID 102491266
3,3-dimethyl-13-(2-methylphenyl)-4,4a,13,13a-tetrahydro-2H-indazolo[2,1-b]phthalazine-1,6,11-trione (PubChem CID 102491266) has the molecular formula C24H24N2O3 and a molecular weight of 388.47 g/mol. Its IUPAC name is 3,3-dimethyl-13-(2-methylphenyl)-4,4a,13,13a-tetrahydro-2H-indazolo[2,1-b]phthalazine-1,6,11-trione.
| Compound Name | 3,3-dimethyl-13-(2-methylphenyl)-4,4a,13,13a-tetrahydro-2H-indazolo[2,1-b]phthalazine-1,6,11-trione |
|---|---|
| PubChem CID | 102491266 |
| Molecular Formula | C24H24N2O3 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | 3,3-dimethyl-13-(2-methylphenyl)-4,4a,13,13a-tetrahydro-2H-indazolo[2,1-b]phthalazine-1,6,11-trione |
| SMILES | Cc1ccccc1C1C2C(=O)CC(C)(C)CC2n2c(=O)c3ccccc3c(=O)n21 |
| InChI | InChI=1S/C24H24N2O3/c1-14-8-4-5-9-15(14)21-20-18(12-24(2,3)13-19(20)27)25-22(28)16-10-6-7-11-17(16)23(29)26(21)25/h4-11,18,20-21H,12-13H2,1-3H3 |
| InChIKey | FTBCGZSQWAUQPN-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 61.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |