C13H10F3N3O2 — CID 102491406
5-benzyl-3-(trifluoromethyl)-3a,6a-dihydro-3H-pyrrolo[3,4-c]pyrazole-4,6-dione (PubChem CID 102491406) has the molecular formula C13H10F3N3O2 and a molecular weight of 297.24 g/mol. Its IUPAC name is 5-benzyl-3-(trifluoromethyl)-3a,6a-dihydro-3H-pyrrolo[3,4-c]pyrazole-4,6-dione.
| Compound Name | 5-benzyl-3-(trifluoromethyl)-3a,6a-dihydro-3H-pyrrolo[3,4-c]pyrazole-4,6-dione |
|---|---|
| PubChem CID | 102491406 |
| Molecular Formula | C13H10F3N3O2 |
| Molecular Weight | 297.24 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | 5-benzyl-3-(trifluoromethyl)-3a,6a-dihydro-3H-pyrrolo[3,4-c]pyrazole-4,6-dione |
| SMILES | O=C1C2N=NC(C(F)(F)F)C2C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C13H10F3N3O2/c14-13(15,16)10-8-9(17-18-10)12(21)19(11(8)20)6-7-4-2-1-3-5-7/h1-5,8-10H,6H2 |
| InChIKey | ZIJICMWFTFYZHN-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 62.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.24 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|