C27H23N3O — CID 102491459
(10S,13R,14S)-11-benzyl-8-methyl-13-phenyl-12-oxa-1,11-diazatetracyclo[7.6.0.02,7.010,14]pentadeca-2,4,6,8-tetraene-14-carbonitrile (PubChem CID 102491459) has the molecular formula C27H23N3O and a molecular weight of 405.50 g/mol. Its IUPAC name is (10S,13R,14S)-11-benzyl-8-methyl-13-phenyl-12-oxa-1,11-diazatetracyclo[7.6.0.02,7.010,14]pentadeca-2,4,6,8-tetraene-14-carbonitrile.
| Compound Name | (10S,13R,14S)-11-benzyl-8-methyl-13-phenyl-12-oxa-1,11-diazatetracyclo[7.6.0.02,7.010,14]pentadeca-2,4,6,8-tetraene-14-carbonitrile |
|---|---|
| PubChem CID | 102491459 |
| Molecular Formula | C27H23N3O |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | (10S,13R,14S)-11-benzyl-8-methyl-13-phenyl-12-oxa-1,11-diazatetracyclo[7.6.0.02,7.010,14]pentadeca-2,4,6,8-tetraene-14-carbonitrile |
| SMILES | Cc1c2n(c3ccccc13)C[C@]1(C#N)[C@@H](c3ccccc3)ON(Cc3ccccc3)[C@H]21 |
| InChI | InChI=1S/C27H23N3O/c1-19-22-14-8-9-15-23(22)29-18-27(17-28)25(24(19)29)30(16-20-10-4-2-5-11-20)31-26(27)21-12-6-3-7-13-21/h2-15,25-26H,16,18H2,1H3/t25-,26-,27+/m1/s1 |
| InChIKey | YHAQFRUYPYCZFZ-PFBJBMPXSA-N |
| XLogP | 5.70 |
| TPSA | 41.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|