About 3-cyclopentyloxy-N-(2,6-dichlorophenyl)-4-methoxybenzamide
3-cyclopentyloxy-N-(2,6-dichlorophenyl)-4-methoxybenzamide (PubChem CID 10249183) has the molecular formula C19H19Cl2NO3
and a molecular weight of 380.27 g/mol. Its IUPAC name is 3-cyclopentyloxy-N-(2,6-dichlorophenyl)-4-methoxybenzamide.
Molecular Properties
| Compound Name | 3-cyclopentyloxy-N-(2,6-dichlorophenyl)-4-methoxybenzamide |
| PubChem CID | 10249183 |
| Molecular Formula | C19H19Cl2NO3 |
| Molecular Weight | 380.27 g/mol |
| Exact Mass | 379.07 |
| IUPAC Name | 3-cyclopentyloxy-N-(2,6-dichlorophenyl)-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2c(Cl)cccc2Cl)cc1OC1CCCC1 |
| InChI | InChI=1S/C19H19Cl2NO3/c1-24-16-10-9-12(11-17(16)25-13-5-2-3-6-13)19(23)22-18-14(20)7-4-8-15(18)21/h4,7-11,13H,2-3,5-6H2,1H3,(H,22,23) |
| InChIKey | IEIYCAUGLWVZTR-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 380.27 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-cyclopentyloxy-N-(2,6-dichlorophenyl)-4-methoxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclopentyloxy-N-(2,6-dichlorophenyl)-4-methoxybenzamide?
The IUPAC name of 3-cyclopentyloxy-N-(2,6-dichlorophenyl)-4-methoxybenzamide (CID 10249183) is 3-cyclopentyloxy-N-(2,6-dichlorophenyl)-4-methoxybenzamide.
What is the SMILES notation for 3-cyclopentyloxy-N-(2,6-dichlorophenyl)-4-methoxybenzamide?
The canonical SMILES for 3-cyclopentyloxy-N-(2,6-dichlorophenyl)-4-methoxybenzamide is COc1ccc(C(=O)Nc2c(Cl)cccc2Cl)cc1OC1CCCC1.
What is the InChIKey of 3-cyclopentyloxy-N-(2,6-dichlorophenyl)-4-methoxybenzamide?
The InChIKey is IEIYCAUGLWVZTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19Cl2NO3/c1-24-16-10-9-12(11-17(16)25-13-5-2-3-6-13)19(23)22-18-14(20)7-4-8-15(18)21/h4,7-11,13H,2-3,5-6H2,1H3,(H,22,23).
What are the key properties of 3-cyclopentyloxy-N-(2,6-dichlorophenyl)-4-methoxybenzamide?
3-cyclopentyloxy-N-(2,6-dichlorophenyl)-4-methoxybenzamide has a molecular weight of 380.27 g/mol, XLogP of 5.58, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclopentyloxy-N-(2,6-dichlorophenyl)-4-methoxybenzamide is sourced from PubChem (CID 10249183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).