C22H24N2O2S — CID 10249221
1-[4-(2,4-dimethoxyphenyl)-4H-pyrrolo[2,1-c][1,4]benzothiazin-1-yl]-N,N-dimethylmethanamine (PubChem CID 10249221) has the molecular formula C22H24N2O2S and a molecular weight of 380.51 g/mol. Its IUPAC name is 1-[4-(2,4-dimethoxyphenyl)-4H-pyrrolo[2,1-c][1,4]benzothiazin-1-yl]-N,N-dimethylmethanamine.
| Compound Name | 1-[4-(2,4-dimethoxyphenyl)-4H-pyrrolo[2,1-c][1,4]benzothiazin-1-yl]-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 10249221 |
| Molecular Formula | C22H24N2O2S |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | 1-[4-(2,4-dimethoxyphenyl)-4H-pyrrolo[2,1-c][1,4]benzothiazin-1-yl]-N,N-dimethylmethanamine |
| SMILES | COc1ccc(C2Sc3ccccc3-n3c(CN(C)C)ccc32)c(OC)c1 |
| InChI | InChI=1S/C22H24N2O2S/c1-23(2)14-15-9-12-19-22(17-11-10-16(25-3)13-20(17)26-4)27-21-8-6-5-7-18(21)24(15)19/h5-13,22H,14H2,1-4H3 |
| InChIKey | ICMCIDYUTSXGGO-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 26.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|