About 5-[3-(3,5-difluoro-2-pyridinyl)-4-fluorophenyl]-3-(4-fluorophenyl)pyridazine
5-[3-(3,5-difluoro-2-pyridinyl)-4-fluorophenyl]-3-(4-fluorophenyl)pyridazine (PubChem CID 10249256) has the molecular formula C21H11F4N3
and a molecular weight of 381.33 g/mol. Its IUPAC name is 5-[3-(3,5-difluoro-2-pyridinyl)-4-fluorophenyl]-3-(4-fluorophenyl)pyridazine.
Molecular Properties
| Compound Name | 5-[3-(3,5-difluoro-2-pyridinyl)-4-fluorophenyl]-3-(4-fluorophenyl)pyridazine |
| PubChem CID | 10249256 |
| Molecular Formula | C21H11F4N3 |
| Molecular Weight | 381.33 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | 5-[3-(3,5-difluoro-2-pyridinyl)-4-fluorophenyl]-3-(4-fluorophenyl)pyridazine |
| SMILES | Fc1ccc(-c2cc(-c3ccc(F)c(-c4ncc(F)cc4F)c3)cnn2)cc1 |
| InChI | InChI=1S/C21H11F4N3/c22-15-4-1-12(2-5-15)20-8-14(10-27-28-20)13-3-6-18(24)17(7-13)21-19(25)9-16(23)11-26-21/h1-11H |
| InChIKey | BEUFUKHUURWENE-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 381.33 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[3-(3,5-difluoro-2-pyridinyl)-4-fluorophenyl]-3-(4-fluorophenyl)pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[3-(3,5-difluoro-2-pyridinyl)-4-fluorophenyl]-3-(4-fluorophenyl)pyridazine?
The IUPAC name of 5-[3-(3,5-difluoro-2-pyridinyl)-4-fluorophenyl]-3-(4-fluorophenyl)pyridazine (CID 10249256) is 5-[3-(3,5-difluoro-2-pyridinyl)-4-fluorophenyl]-3-(4-fluorophenyl)pyridazine.
What is the SMILES notation for 5-[3-(3,5-difluoro-2-pyridinyl)-4-fluorophenyl]-3-(4-fluorophenyl)pyridazine?
The canonical SMILES for 5-[3-(3,5-difluoro-2-pyridinyl)-4-fluorophenyl]-3-(4-fluorophenyl)pyridazine is Fc1ccc(-c2cc(-c3ccc(F)c(-c4ncc(F)cc4F)c3)cnn2)cc1.
What is the InChIKey of 5-[3-(3,5-difluoro-2-pyridinyl)-4-fluorophenyl]-3-(4-fluorophenyl)pyridazine?
The InChIKey is BEUFUKHUURWENE-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H11F4N3/c22-15-4-1-12(2-5-15)20-8-14(10-27-28-20)13-3-6-18(24)17(7-13)21-19(25)9-16(23)11-26-21/h1-11H.
What are the key properties of 5-[3-(3,5-difluoro-2-pyridinyl)-4-fluorophenyl]-3-(4-fluorophenyl)pyridazine?
5-[3-(3,5-difluoro-2-pyridinyl)-4-fluorophenyl]-3-(4-fluorophenyl)pyridazine has a molecular weight of 381.33 g/mol, XLogP of 5.43, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[3-(3,5-difluoro-2-pyridinyl)-4-fluorophenyl]-3-(4-fluorophenyl)pyridazine is sourced from PubChem (CID 10249256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).