C28H35N3O2 — CID 102492662
N'-tert-butyl-2-(4-methoxyanilino)-N-(4-methoxyphenyl)-4-phenylbutanimidamide (PubChem CID 102492662) has the molecular formula C28H35N3O2 and a molecular weight of 445.61 g/mol. Its IUPAC name is N'-tert-butyl-2-(4-methoxyanilino)-N-(4-methoxyphenyl)-4-phenylbutanimidamide.
| Compound Name | N'-tert-butyl-2-(4-methoxyanilino)-N-(4-methoxyphenyl)-4-phenylbutanimidamide |
|---|---|
| PubChem CID | 102492662 |
| Molecular Formula | C28H35N3O2 |
| Molecular Weight | 445.61 g/mol |
| Exact Mass | 445.27 |
| IUPAC Name | N'-tert-butyl-2-(4-methoxyanilino)-N-(4-methoxyphenyl)-4-phenylbutanimidamide |
| SMILES | COc1ccc(N/C(=N\C(C)(C)C)C(CCc2ccccc2)Nc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C28H35N3O2/c1-28(2,3)31-27(30-23-14-18-25(33-5)19-15-23)26(20-11-21-9-7-6-8-10-21)29-22-12-16-24(32-4)17-13-22/h6-10,12-19,26,29H,11,20H2,1-5H3,(H,30,31) |
| InChIKey | WSBUABHOPZXLQB-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.61 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|