C12H21BO2 — CID 102493054
2-cyclohex-3-en-1-yl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 102493054) has the molecular formula C12H21BO2 and a molecular weight of 208.11 g/mol. Its IUPAC name is 2-cyclohex-3-en-1-yl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-cyclohex-3-en-1-yl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 102493054 |
| Molecular Formula | C12H21BO2 |
| Molecular Weight | 208.11 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | 2-cyclohex-3-en-1-yl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(C2CC=CCC2)OC1(C)C |
| InChI | InChI=1S/C12H21BO2/c1-11(2)12(3,4)15-13(14-11)10-8-6-5-7-9-10/h5-6,10H,7-9H2,1-4H3 |
| InChIKey | PFEXYFWMYBJMQK-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.11 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|